C14H17ClN2O4 — CID 110706569
methyl 4-chloro-3-(oxolan-2-ylmethylcarbamoylamino)benzoate (PubChem CID 110706569) has the molecular formula C14H17ClN2O4 and a molecular weight of 312.75 g/mol. Its IUPAC name is methyl 4-chloro-3-(oxolan-2-ylmethylcarbamoylamino)benzoate.
| Compound Name | methyl 4-chloro-3-(oxolan-2-ylmethylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 110706569 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | methyl 4-chloro-3-(oxolan-2-ylmethylcarbamoylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-20-13(18)9-4-5-11(15)12(7-9)17-14(19)16-8-10-3-2-6-21-10/h4-5,7,10H,2-3,6,8H2,1H3,(H2,16,17,19) |
| InChIKey | RKXLOJOJMAFGQI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |