C16H19ClN2O5 — CID 108943737
methyl 4-chloro-3-[[3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate (PubChem CID 108943737) has the molecular formula C16H19ClN2O5 and a molecular weight of 354.79 g/mol. Its IUPAC name is methyl 4-chloro-3-[[3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108943737 |
| Molecular Formula | C16H19ClN2O5 |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 4-chloro-3-[[3-oxo-3-(oxolan-2-ylmethylamino)propanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)CC(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C16H19ClN2O5/c1-23-16(22)10-4-5-12(17)13(7-10)19-15(21)8-14(20)18-9-11-3-2-6-24-11/h4-5,7,11H,2-3,6,8-9H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | SDNFAWDKBAFSSK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|