C15H21ClN2O4 — CID 95177667
1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 95177667) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95177667 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[3-chloro-2-(2-methoxyethoxy)phenyl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C15H21ClN2O4/c1-20-8-9-22-14-12(16)5-2-6-13(14)18-15(19)17-10-11-4-3-7-21-11/h2,5-6,11H,3-4,7-10H2,1H3,(H2,17,18,19)/t11-/m0/s1 |
| InChIKey | RGSVUMRXZYIMGO-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|