C26H26ClNO5 — CID 42427203
N-[3-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 42427203) has the molecular formula C26H26ClNO5 and a molecular weight of 467.95 g/mol. Its IUPAC name is N-[3-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[3-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 42427203 |
| Molecular Formula | C26H26ClNO5 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | N-[3-chloro-2-[[(2S)-oxolan-2-yl]methoxy]phenyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1OC[C@@H]1CCCO1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C26H26ClNO5/c27-23-12-5-13-24(25(23)33-18-22-11-6-14-30-22)28-26(29)19-7-4-10-21(17-19)32-16-15-31-20-8-2-1-3-9-20/h1-5,7-10,12-13,17,22H,6,11,14-16,18H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | BCLVNXJYFOHIIK-QFIPXVFZSA-N |
| XLogP | 5.61 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|