C20H20N4O3 — CID 134004359
3-(oxolan-2-ylmethoxy)-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 134004359) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethoxy)-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 3-(oxolan-2-ylmethoxy)-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 134004359 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-(oxolan-2-ylmethoxy)-N-[2-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-n1cncn1)c1cccc(OCC2CCCO2)c1 |
| InChI | InChI=1S/C20H20N4O3/c25-20(23-18-8-1-2-9-19(18)24-14-21-13-22-24)15-5-3-6-16(11-15)27-12-17-7-4-10-26-17/h1-3,5-6,8-9,11,13-14,17H,4,7,10,12H2,(H,23,25) |
| InChIKey | JTCDZYVATSHOFX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |