C21H32N2O2 — CID 135089657
1-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[methyl-[(4-methylphenyl)methyl]amino]ethanone (PubChem CID 135089657) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[methyl-[(4-methylphenyl)methyl]amino]ethanone.
| Compound Name | 1-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[methyl-[(4-methylphenyl)methyl]amino]ethanone |
|---|---|
| PubChem CID | 135089657 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1-[(3aS,7R,7aR)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[methyl-[(4-methylphenyl)methyl]amino]ethanone |
| SMILES | CC[C@@]1(O)CCC[C@@H]2CN(C(=O)CN(C)Cc3ccc(C)cc3)C[C@@H]21 |
| InChI | InChI=1S/C21H32N2O2/c1-4-21(25)11-5-6-18-13-23(14-19(18)21)20(24)15-22(3)12-17-9-7-16(2)8-10-17/h7-10,18-19,25H,4-6,11-15H2,1-3H3/t18-,19+,21-/m1/s1 |
| InChIKey | IITSLHJXEIDBAX-SVFBPWRDSA-N |
| XLogP | 2.83 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |