C18H24F3NO — CID 162629947
(3aS,4S,7aR)-4-ethyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 162629947) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is (3aS,4S,7aR)-4-ethyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | (3aS,4S,7aR)-4-ethyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 162629947 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3aS,4S,7aR)-4-ethyl-2-[[2-(trifluoromethyl)phenyl]methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(Cc3ccccc3C(F)(F)F)C[C@H]21 |
| InChI | InChI=1S/C18H24F3NO/c1-2-17(23)9-5-7-14-11-22(12-16(14)17)10-13-6-3-4-8-15(13)18(19,20)21/h3-4,6,8,14,16,23H,2,5,7,9-12H2,1H3/t14-,16+,17-/m0/s1 |
| InChIKey | ZHBHRULJVTXFQW-UAGQMJEPSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |