C19H27NO4 — CID 163305071
5-[[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]-2-methoxybenzoic acid (PubChem CID 163305071) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 5-[[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 163305071 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 5-[[(3aR,7S,7aS)-7-ethyl-7-hydroxy-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]methyl]-2-methoxybenzoic acid |
| SMILES | CC[C@]1(O)CCC[C@H]2CN(Cc3ccc(OC)c(C(=O)O)c3)C[C@H]21 |
| InChI | InChI=1S/C19H27NO4/c1-3-19(23)8-4-5-14-11-20(12-16(14)19)10-13-6-7-17(24-2)15(9-13)18(21)22/h6-7,9,14,16,23H,3-5,8,10-12H2,1-2H3,(H,21,22)/t14-,16+,19-/m0/s1 |
| InChIKey | CSZVVHFGOQKOGP-GMBSWORKSA-N |
| XLogP | 2.77 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |