C15H19ClF3NO3 — CID 171385032
2-methoxy-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoic acid;hydrochloride (PubChem CID 171385032) has the molecular formula C15H19ClF3NO3 and a molecular weight of 353.77 g/mol. Its IUPAC name is 2-methoxy-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoic acid;hydrochloride.
| Compound Name | 2-methoxy-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 171385032 |
| Molecular Formula | C15H19ClF3NO3 |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2-methoxy-5-[[4-(trifluoromethyl)piperidin-1-yl]methyl]benzoic acid;hydrochloride |
| SMILES | COc1ccc(CN2CCC(C(F)(F)F)CC2)cc1C(=O)O.Cl |
| InChI | InChI=1S/C15H18F3NO3.ClH/c1-22-13-3-2-10(8-12(13)14(20)21)9-19-6-4-11(5-7-19)15(16,17)18;/h2-3,8,11H,4-7,9H2,1H3,(H,20,21);1H |
| InChIKey | BFQWNDKPIOXOKY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |