C27H32N2O3 — CID 11743551
5-[[4-[1-(2-cyclopropylethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid (PubChem CID 11743551) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is 5-[[4-[1-(2-cyclopropylethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[[4-[1-(2-cyclopropylethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 11743551 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 5-[[4-[1-(2-cyclopropylethyl)indol-3-yl]piperidin-1-yl]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(CN2CCC(c3cn(CCC4CC4)c4ccccc34)CC2)cc1C(=O)O |
| InChI | InChI=1S/C27H32N2O3/c1-32-26-9-8-20(16-23(26)27(30)31)17-28-13-11-21(12-14-28)24-18-29(15-10-19-6-7-19)25-5-3-2-4-22(24)25/h2-5,8-9,16,18-19,21H,6-7,10-15,17H2,1H3,(H,30,31) |
| InChIKey | XHIJRFMHQFLSNS-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |