methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate

C17H25NO4 — CID 16767490

IUPACmethyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate
SMILESCOC(=O)CC1CCN(Cc2ccc(OC)c(OC)c2)CC1
InChIInChI=1S/C17H25NO4/c1-20-15-5-4-14(10-16(15)21-2)12-18-8-6-13(7-9-18)11-17(19)22-3/h4-5,10,13H,6-9,11-12H2,1-3H3
InChIKeyRPMCKJFDDXUSQM-UHFFFAOYSA-N
MW307.39 g/mol
LogP2.48
Rot. Bonds6

About methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate

methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate (PubChem CID 16767490) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate
PubChem CID16767490
Molecular FormulaC17H25NO4
Molecular Weight307.39 g/mol
Exact Mass307.18
IUPAC Namemethyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate
SMILESCOC(=O)CC1CCN(Cc2ccc(OC)c(OC)c2)CC1
InChIInChI=1S/C17H25NO4/c1-20-15-5-4-14(10-16(15)21-2)12-18-8-6-13(7-9-18)11-17(19)22-3/h4-5,10,13H,6-9,11-12H2,1-3H3
InChIKeyRPMCKJFDDXUSQM-UHFFFAOYSA-N
XLogP2.48
TPSA48.00 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.39
LogP ≤ 52.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate?
The IUPAC name of methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate (CID 16767490) is methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate.
What is the SMILES notation for methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate?
The canonical SMILES for methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate is COC(=O)CC1CCN(Cc2ccc(OC)c(OC)c2)CC1.
What is the InChIKey of methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate?
The InChIKey is RPMCKJFDDXUSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-20-15-5-4-14(10-16(15)21-2)12-18-8-6-13(7-9-18)11-17(19)22-3/h4-5,10,13H,6-9,11-12H2,1-3H3.
What are the key properties of methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate?
methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate has a molecular weight of 307.39 g/mol, XLogP of 2.48, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(3,4-dimethoxyphenyl)methyl]piperidin-4-yl]acetate is sourced from PubChem (CID 16767490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).