methane;methyl 2-(1-benzylpiperidin-4-yl)acetate

C16H25NO2 — CID 78582433

IUPACmethane;methyl 2-(1-benzylpiperidin-4-yl)acetate
SMILESC.COC(=O)CC1CCN(Cc2ccccc2)CC1
InChIInChI=1S/C15H21NO2.CH4/c1-18-15(17)11-13-7-9-16(10-8-13)12-14-5-3-2-4-6-14;/h2-6,13H,7-12H2,1H3;1H4
InChIKeySWQNOIQXSKQLPV-UHFFFAOYSA-N
MW263.38 g/mol
LogP3.10
Rot. Bonds4

About methane;methyl 2-(1-benzylpiperidin-4-yl)acetate

methane;methyl 2-(1-benzylpiperidin-4-yl)acetate (PubChem CID 78582433) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is methane;methyl 2-(1-benzylpiperidin-4-yl)acetate.

Molecular Properties

Compound Namemethane;methyl 2-(1-benzylpiperidin-4-yl)acetate
PubChem CID78582433
Molecular FormulaC16H25NO2
Molecular Weight263.38 g/mol
Exact Mass263.19
IUPAC Namemethane;methyl 2-(1-benzylpiperidin-4-yl)acetate
SMILESC.COC(=O)CC1CCN(Cc2ccccc2)CC1
InChIInChI=1S/C15H21NO2.CH4/c1-18-15(17)11-13-7-9-16(10-8-13)12-14-5-3-2-4-6-14;/h2-6,13H,7-12H2,1H3;1H4
InChIKeySWQNOIQXSKQLPV-UHFFFAOYSA-N
XLogP3.10
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.38
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methane;methyl 2-(1-benzylpiperidin-4-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The IUPAC name of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate (CID 78582433) is methane;methyl 2-(1-benzylpiperidin-4-yl)acetate.
What is the SMILES notation for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The canonical SMILES for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate is C.COC(=O)CC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The InChIKey is SWQNOIQXSKQLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2.CH4/c1-18-15(17)11-13-7-9-16(10-8-13)12-14-5-3-2-4-6-14;/h2-6,13H,7-12H2,1H3;1H4.
What are the key properties of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
methane;methyl 2-(1-benzylpiperidin-4-yl)acetate has a molecular weight of 263.38 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate is sourced from PubChem (CID 78582433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).