About methane;methyl 2-(1-benzylpiperidin-4-yl)acetate
methane;methyl 2-(1-benzylpiperidin-4-yl)acetate (PubChem CID 78582433) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is methane;methyl 2-(1-benzylpiperidin-4-yl)acetate.
Molecular Properties
| Compound Name | methane;methyl 2-(1-benzylpiperidin-4-yl)acetate |
| PubChem CID | 78582433 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | methane;methyl 2-(1-benzylpiperidin-4-yl)acetate |
| SMILES | C.COC(=O)CC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H21NO2.CH4/c1-18-15(17)11-13-7-9-16(10-8-13)12-14-5-3-2-4-6-14;/h2-6,13H,7-12H2,1H3;1H4 |
| InChIKey | SWQNOIQXSKQLPV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;methyl 2-(1-benzylpiperidin-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The IUPAC name of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate (CID 78582433) is methane;methyl 2-(1-benzylpiperidin-4-yl)acetate.
What is the SMILES notation for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The canonical SMILES for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate is C.COC(=O)CC1CCN(Cc2ccccc2)CC1.
What is the InChIKey of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
The InChIKey is SWQNOIQXSKQLPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2.CH4/c1-18-15(17)11-13-7-9-16(10-8-13)12-14-5-3-2-4-6-14;/h2-6,13H,7-12H2,1H3;1H4.
What are the key properties of methane;methyl 2-(1-benzylpiperidin-4-yl)acetate?
methane;methyl 2-(1-benzylpiperidin-4-yl)acetate has a molecular weight of 263.38 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methyl 2-(1-benzylpiperidin-4-yl)acetate is sourced from PubChem (CID 78582433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).