About methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride
methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride (PubChem CID 14518101) has the molecular formula C15H24Cl2N2O
and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride |
| PubChem CID | 14518101 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(/CC1CCN(Cc2ccccc2)CC1)OC |
| InChI | InChI=1S/C15H22N2O.2ClH/c1-18-15(16)11-13-7-9-17(10-8-13)12-14-5-3-2-4-6-14;;/h2-6,13,16H,7-12H2,1H3;2*1H/b16-15-;; |
| InChIKey | CUGZQXQOKWTTJS-NDXGFPCWSA-N |
| XLogP | 3.76 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride?
The IUPAC name of methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride (CID 14518101) is methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride.
What is the SMILES notation for methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride?
The canonical SMILES for methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride is Cl.Cl.[H]/N=C(/CC1CCN(Cc2ccccc2)CC1)OC.
What is the InChIKey of methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride?
The InChIKey is CUGZQXQOKWTTJS-NDXGFPCWSA-N. The full InChI is InChI=1S/C15H22N2O.2ClH/c1-18-15(16)11-13-7-9-17(10-8-13)12-14-5-3-2-4-6-14;;/h2-6,13,16H,7-12H2,1H3;2*1H/b16-15-;;.
What are the key properties of methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride?
methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride has a molecular weight of 319.28 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1-benzylpiperidin-4-yl)ethanimidate;dihydrochloride is sourced from PubChem (CID 14518101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).