C19H25N7S — CID 163344571
5-[[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2,4-dimethyl-1,3-thiazole (PubChem CID 163344571) has the molecular formula C19H25N7S and a molecular weight of 383.53 g/mol. Its IUPAC name is 5-[[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2,4-dimethyl-1,3-thiazole.
| Compound Name | 5-[[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2,4-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 163344571 |
| Molecular Formula | C19H25N7S |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 5-[[5-(9-ethylpurin-6-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]methyl]-2,4-dimethyl-1,3-thiazole |
| SMILES | CCn1cnc2c(N3CC4CN(Cc5sc(C)nc5C)CC4C3)ncnc21 |
| InChI | InChI=1S/C19H25N7S/c1-4-25-11-22-17-18(25)20-10-21-19(17)26-7-14-5-24(6-15(14)8-26)9-16-12(2)23-13(3)27-16/h10-11,14-15H,4-9H2,1-3H3 |
| InChIKey | YSXJTWRVBAZEOE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |