C15H24N6 — CID 126818343
6-(2,4-diethylpiperazin-1-yl)-9-ethylpurine (PubChem CID 126818343) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is 6-(2,4-diethylpiperazin-1-yl)-9-ethylpurine.
| Compound Name | 6-(2,4-diethylpiperazin-1-yl)-9-ethylpurine |
|---|---|
| PubChem CID | 126818343 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 6-(2,4-diethylpiperazin-1-yl)-9-ethylpurine |
| SMILES | CCC1CN(CC)CCN1c1ncnc2c1ncn2CC |
| InChI | InChI=1S/C15H24N6/c1-4-12-9-19(5-2)7-8-21(12)15-13-14(16-10-17-15)20(6-3)11-18-13/h10-12H,4-9H2,1-3H3 |
| InChIKey | FJZSMTXZZOSDMH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |