C12H16FN5O — CID 128979586
[(2S,4S)-1-(9-ethylpurin-6-yl)-4-fluoropyrrolidin-2-yl]methanol (PubChem CID 128979586) has the molecular formula C12H16FN5O and a molecular weight of 265.29 g/mol. Its IUPAC name is [(2S,4S)-1-(9-ethylpurin-6-yl)-4-fluoropyrrolidin-2-yl]methanol.
| Compound Name | [(2S,4S)-1-(9-ethylpurin-6-yl)-4-fluoropyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 128979586 |
| Molecular Formula | C12H16FN5O |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [(2S,4S)-1-(9-ethylpurin-6-yl)-4-fluoropyrrolidin-2-yl]methanol |
| SMILES | CCn1cnc2c(N3C[C@@H](F)C[C@H]3CO)ncnc21 |
| InChI | InChI=1S/C12H16FN5O/c1-2-17-7-16-10-11(17)14-6-15-12(10)18-4-8(13)3-9(18)5-19/h6-9,19H,2-5H2,1H3/t8-,9-/m0/s1 |
| InChIKey | FEFUGYAXNQUYDN-IUCAKERBSA-N |
| XLogP | 0.76 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |