About 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine
6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine (PubChem CID 124886979) has the molecular formula C17H20N6
and a molecular weight of 308.39 g/mol. Its IUPAC name is 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine.
Molecular Properties
| Compound Name | 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine |
| PubChem CID | 124886979 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine |
| SMILES | CCn1cnc2c(N3CC(C)(C)[C@@H]3c3cccnc3)ncnc21 |
| InChI | InChI=1S/C17H20N6/c1-4-22-11-21-13-15(22)19-10-20-16(13)23-9-17(2,3)14(23)12-6-5-7-18-8-12/h5-8,10-11,14H,4,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | ANLGFUIUYOCIGT-AWEZNQCLSA-N |
| XLogP | 2.83 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine?
The IUPAC name of 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine (CID 124886979) is 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine.
What is the SMILES notation for 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine?
The canonical SMILES for 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine is CCn1cnc2c(N3CC(C)(C)[C@@H]3c3cccnc3)ncnc21.
What is the InChIKey of 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine?
The InChIKey is ANLGFUIUYOCIGT-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H20N6/c1-4-22-11-21-13-15(22)19-10-20-16(13)23-9-17(2,3)14(23)12-6-5-7-18-8-12/h5-8,10-11,14H,4,9H2,1-3H3/t14-/m0/s1.
What are the key properties of 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine?
6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine has a molecular weight of 308.39 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2R)-3,3-dimethyl-2-pyridin-3-ylazetidin-1-yl]-9-ethylpurine is sourced from PubChem (CID 124886979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).