C17H19N7O — CID 129447691
(3S)-3-[(9-ethylpurin-6-yl)amino]-1-pyridin-3-ylpiperidin-2-one (PubChem CID 129447691) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is (3S)-3-[(9-ethylpurin-6-yl)amino]-1-pyridin-3-ylpiperidin-2-one.
| Compound Name | (3S)-3-[(9-ethylpurin-6-yl)amino]-1-pyridin-3-ylpiperidin-2-one |
|---|---|
| PubChem CID | 129447691 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3S)-3-[(9-ethylpurin-6-yl)amino]-1-pyridin-3-ylpiperidin-2-one |
| SMILES | CCn1cnc2c(N[C@H]3CCCN(c4cccnc4)C3=O)ncnc21 |
| InChI | InChI=1S/C17H19N7O/c1-2-23-11-21-14-15(19-10-20-16(14)23)22-13-6-4-8-24(17(13)25)12-5-3-7-18-9-12/h3,5,7,9-11,13H,2,4,6,8H2,1H3,(H,19,20,22)/t13-/m0/s1 |
| InChIKey | WOHVSBULRYZONC-ZDUSSCGKSA-N |
| XLogP | 1.85 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |