C18H20N4O3 — CID 124616584
methyl (2S)-2-[[(3S)-2-oxo-1-pyridin-3-ylpiperidin-3-yl]amino]-2-pyridin-3-ylacetate (PubChem CID 124616584) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl (2S)-2-[[(3S)-2-oxo-1-pyridin-3-ylpiperidin-3-yl]amino]-2-pyridin-3-ylacetate.
| Compound Name | methyl (2S)-2-[[(3S)-2-oxo-1-pyridin-3-ylpiperidin-3-yl]amino]-2-pyridin-3-ylacetate |
|---|---|
| PubChem CID | 124616584 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl (2S)-2-[[(3S)-2-oxo-1-pyridin-3-ylpiperidin-3-yl]amino]-2-pyridin-3-ylacetate |
| SMILES | COC(=O)[C@@H](N[C@H]1CCCN(c2cccnc2)C1=O)c1cccnc1 |
| InChI | InChI=1S/C18H20N4O3/c1-25-18(24)16(13-5-2-8-19-11-13)21-15-7-4-10-22(17(15)23)14-6-3-9-20-12-14/h2-3,5-6,8-9,11-12,15-16,21H,4,7,10H2,1H3/t15-,16-/m0/s1 |
| InChIKey | VKYOUVMYKMNPTL-HOTGVXAUSA-N |
| XLogP | 1.48 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |