C17H23N3O5 — CID 126811309
tert-butyl (2R)-2-[(2-methoxy-2-oxo-1-pyridin-3-ylethyl)carbamoyl]azetidine-1-carboxylate (PubChem CID 126811309) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-methoxy-2-oxo-1-pyridin-3-ylethyl)carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2-methoxy-2-oxo-1-pyridin-3-ylethyl)carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 126811309 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | tert-butyl (2R)-2-[(2-methoxy-2-oxo-1-pyridin-3-ylethyl)carbamoyl]azetidine-1-carboxylate |
| SMILES | COC(=O)C(NC(=O)[C@H]1CCN1C(=O)OC(C)(C)C)c1cccnc1 |
| InChI | InChI=1S/C17H23N3O5/c1-17(2,3)25-16(23)20-9-7-12(20)14(21)19-13(15(22)24-4)11-6-5-8-18-10-11/h5-6,8,10,12-13H,7,9H2,1-4H3,(H,19,21)/t12-,13?/m1/s1 |
| InChIKey | HNNYEXHCSQIVKE-PZORYLMUSA-N |
| XLogP | 1.42 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |