C28H40N4O3 — CID 91569312
tert-butyl 2-(1,7-dipyridin-3-ylheptan-4-ylcarbamoyl)piperidine-1-carboxylate (PubChem CID 91569312) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is tert-butyl 2-(1,7-dipyridin-3-ylheptan-4-ylcarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1,7-dipyridin-3-ylheptan-4-ylcarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91569312 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl 2-(1,7-dipyridin-3-ylheptan-4-ylcarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)NC(CCCc1cccnc1)CCCc1cccnc1 |
| InChI | InChI=1S/C28H40N4O3/c1-28(2,3)35-27(34)32-19-5-4-16-25(32)26(33)31-24(14-6-10-22-12-8-17-29-20-22)15-7-11-23-13-9-18-30-21-23/h8-9,12-13,17-18,20-21,24-25H,4-7,10-11,14-16,19H2,1-3H3,(H,31,33) |
| InChIKey | UOESJHSGPXDYFV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |