C31H43N3O2 — CID 18727492
N-(1,7-diphenylheptan-4-yl)-1-(piperidine-4-carbonyl)piperidine-2-carboxamide (PubChem CID 18727492) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is N-(1,7-diphenylheptan-4-yl)-1-(piperidine-4-carbonyl)piperidine-2-carboxamide.
| Compound Name | N-(1,7-diphenylheptan-4-yl)-1-(piperidine-4-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 18727492 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-(1,7-diphenylheptan-4-yl)-1-(piperidine-4-carbonyl)piperidine-2-carboxamide |
| SMILES | O=C(NC(CCCc1ccccc1)CCCc1ccccc1)C1CCCCN1C(=O)C1CCNCC1 |
| InChI | InChI=1S/C31H43N3O2/c35-30(29-19-7-8-24-34(29)31(36)27-20-22-32-23-21-27)33-28(17-9-15-25-11-3-1-4-12-25)18-10-16-26-13-5-2-6-14-26/h1-6,11-14,27-29,32H,7-10,15-24H2,(H,33,35) |
| InChIKey | KKLJFLHPSULXFD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |