C22H29ClN2O — CID 119813623
N-(1,5-diphenylpentan-3-yl)pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119813623) has the molecular formula C22H29ClN2O and a molecular weight of 372.94 g/mol. Its IUPAC name is N-(1,5-diphenylpentan-3-yl)pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-(1,5-diphenylpentan-3-yl)pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119813623 |
| Molecular Formula | C22H29ClN2O |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-(1,5-diphenylpentan-3-yl)pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC(CCc1ccccc1)CCc1ccccc1)C1CCNC1 |
| InChI | InChI=1S/C22H28N2O.ClH/c25-22(20-15-16-23-17-20)24-21(13-11-18-7-3-1-4-8-18)14-12-19-9-5-2-6-10-19;/h1-10,20-21,23H,11-17H2,(H,24,25);1H |
| InChIKey | ZGWQCSKBAOMERF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |