C19H30N2O — CID 120635934
(2S,4S)-2-methyl-N-(1-phenylhexan-3-yl)piperidine-4-carboxamide (PubChem CID 120635934) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (2S,4S)-2-methyl-N-(1-phenylhexan-3-yl)piperidine-4-carboxamide.
| Compound Name | (2S,4S)-2-methyl-N-(1-phenylhexan-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 120635934 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (2S,4S)-2-methyl-N-(1-phenylhexan-3-yl)piperidine-4-carboxamide |
| SMILES | CCCC(CCc1ccccc1)NC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C19H30N2O/c1-3-7-18(11-10-16-8-5-4-6-9-16)21-19(22)17-12-13-20-15(2)14-17/h4-6,8-9,15,17-18,20H,3,7,10-14H2,1-2H3,(H,21,22)/t15-,17-,18?/m0/s1 |
| InChIKey | CLKLPFPTOPTHEC-LUIZSJORSA-N |
| XLogP | 3.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |