C25H35N3O — CID 142137849
1-amino-N-(1,7-diphenylheptan-4-yl)piperidine-3-carboxamide (PubChem CID 142137849) has the molecular formula C25H35N3O and a molecular weight of 393.57 g/mol. Its IUPAC name is 1-amino-N-(1,7-diphenylheptan-4-yl)piperidine-3-carboxamide.
| Compound Name | 1-amino-N-(1,7-diphenylheptan-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 142137849 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 1-amino-N-(1,7-diphenylheptan-4-yl)piperidine-3-carboxamide |
| SMILES | NN1CCCC(C(=O)NC(CCCc2ccccc2)CCCc2ccccc2)C1 |
| InChI | InChI=1S/C25H35N3O/c26-28-19-9-16-23(20-28)25(29)27-24(17-7-14-21-10-3-1-4-11-21)18-8-15-22-12-5-2-6-13-22/h1-6,10-13,23-24H,7-9,14-20,26H2,(H,27,29) |
| InChIKey | JGAYEWUFLNJHTA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|