C29H38N2O2 — CID 18727466
1-but-3-enoyl-N-(1,7-diphenylheptan-4-yl)piperidine-4-carboxamide (PubChem CID 18727466) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 1-but-3-enoyl-N-(1,7-diphenylheptan-4-yl)piperidine-4-carboxamide.
| Compound Name | 1-but-3-enoyl-N-(1,7-diphenylheptan-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 18727466 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-but-3-enoyl-N-(1,7-diphenylheptan-4-yl)piperidine-4-carboxamide |
| SMILES | C=CCC(=O)N1CCC(C(=O)NC(CCCc2ccccc2)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C29H38N2O2/c1-2-11-28(32)31-22-20-26(21-23-31)29(33)30-27(18-9-16-24-12-5-3-6-13-24)19-10-17-25-14-7-4-8-15-25/h2-8,12-15,26-27H,1,9-11,16-23H2,(H,30,33) |
| InChIKey | HIQGLHRNGPRLQV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|