C32H46N2O3 — CID 59898570
tert-butyl N-[[4-(1,7-diphenylheptan-4-ylcarbamoyl)cyclohexyl]methyl]carbamate (PubChem CID 59898570) has the molecular formula C32H46N2O3 and a molecular weight of 506.73 g/mol. Its IUPAC name is tert-butyl N-[[4-(1,7-diphenylheptan-4-ylcarbamoyl)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(1,7-diphenylheptan-4-ylcarbamoyl)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 59898570 |
| Molecular Formula | C32H46N2O3 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | tert-butyl N-[[4-(1,7-diphenylheptan-4-ylcarbamoyl)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)NC(CCCc2ccccc2)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H46N2O3/c1-32(2,3)37-31(36)33-24-27-20-22-28(23-21-27)30(35)34-29(18-10-16-25-12-6-4-7-13-25)19-11-17-26-14-8-5-9-15-26/h4-9,12-15,27-29H,10-11,16-24H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | SFIOLUGJWSORHT-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |