C30H40N4O5 — CID 10768699
tert-butyl N-[[4-[[(2S)-1-[4-(2-amino-2-oxoethyl)anilino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate (PubChem CID 10768699) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(2S)-1-[4-(2-amino-2-oxoethyl)anilino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[(2S)-1-[4-(2-amino-2-oxoethyl)anilino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 10768699 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | tert-butyl N-[[4-[[(2S)-1-[4-(2-amino-2-oxoethyl)anilino]-1-oxo-3-phenylpropan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)N[C@@H](Cc2ccccc2)C(=O)Nc2ccc(CC(N)=O)cc2)CC1 |
| InChI | InChI=1S/C30H40N4O5/c1-30(2,3)39-29(38)32-19-22-9-13-23(14-10-22)27(36)34-25(17-20-7-5-4-6-8-20)28(37)33-24-15-11-21(12-16-24)18-26(31)35/h4-8,11-12,15-16,22-23,25H,9-10,13-14,17-19H2,1-3H3,(H2,31,35)(H,32,38)(H,33,37)(H,34,36)/t22?,23?,25-/m0/s1 |
| InChIKey | MZWNBYBUHWZDEV-RVMZIBIISA-N |
| XLogP | 3.71 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |