C35H48BN7O6 — CID 123310507
tert-butyl N-[[4-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate (PubChem CID 123310507) has the molecular formula C35H48BN7O6 and a molecular weight of 673.62 g/mol. Its IUPAC name is tert-butyl N-[[4-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 123310507 |
| Molecular Formula | C35H48BN7O6 |
| Molecular Weight | 673.62 g/mol |
| Exact Mass | 673.38 |
| IUPAC Name | tert-butyl N-[[4-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)NC(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C35H48BN7O6/c1-33(2,3)47-32(46)37-21-23-8-12-25(13-9-23)30(44)39-28(31(45)38-27-18-14-24(15-19-27)29-40-42-43-41-29)20-22-10-16-26(17-11-22)36-48-34(4,5)35(6,7)49-36/h10-11,14-19,23,25,28H,8-9,12-13,20-21H2,1-7H3,(H,37,46)(H,38,45)(H,39,44)(H,40,41,42,43) |
| InChIKey | GGJWORBJWJLOHL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 169.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.62 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|