C36H50BN7O6 — CID 123697270
tert-butyl N-[[4-[2-oxo-2-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]amino]ethyl]cyclohexyl]methyl]carbamate (PubChem CID 123697270) has the molecular formula C36H50BN7O6 and a molecular weight of 687.65 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-oxo-2-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]amino]ethyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-oxo-2-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]amino]ethyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 123697270 |
| Molecular Formula | C36H50BN7O6 |
| Molecular Weight | 687.65 g/mol |
| Exact Mass | 687.39 |
| IUPAC Name | tert-butyl N-[[4-[2-oxo-2-[[1-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]amino]ethyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC(=O)NC(Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C36H50BN7O6/c1-34(2,3)48-33(47)38-22-25-10-8-24(9-11-25)21-30(45)40-29(32(46)39-28-18-14-26(15-19-28)31-41-43-44-42-31)20-23-12-16-27(17-13-23)37-49-35(4,5)36(6,7)50-37/h12-19,24-25,29H,8-11,20-22H2,1-7H3,(H,38,47)(H,39,46)(H,40,45)(H,41,42,43,44) |
| InChIKey | QUXPQUSOYQVYMQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 169.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|