C37H43N7O6 — CID 122484244
3-[2-methyl-5-[(2S)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]benzoic acid (PubChem CID 122484244) has the molecular formula C37H43N7O6 and a molecular weight of 681.79 g/mol. Its IUPAC name is 3-[2-methyl-5-[(2S)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]benzoic acid.
| Compound Name | 3-[2-methyl-5-[(2S)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 122484244 |
| Molecular Formula | C37H43N7O6 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.33 |
| IUPAC Name | 3-[2-methyl-5-[(2S)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]benzoic acid |
| SMILES | Cc1ccc(C[C@H](NC(=O)C2CCC(CNC(=O)OC(C)(C)C)CC2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)cc1-c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C37H43N7O6/c1-22-8-9-24(18-30(22)27-6-5-7-28(20-27)35(47)48)19-31(34(46)39-29-16-14-25(15-17-29)32-41-43-44-42-32)40-33(45)26-12-10-23(11-13-26)21-38-36(49)50-37(2,3)4/h5-9,14-18,20,23,26,31H,10-13,19,21H2,1-4H3,(H,38,49)(H,39,46)(H,40,45)(H,47,48)(H,41,42,43,44)/t23?,26?,31-/m0/s1 |
| InChIKey | ITMMAUHLQKVLBY-NZEDXHFESA-N |
| XLogP | 5.54 |
| TPSA | 188.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |