C36H42N8O4 — CID 123986650
4-(aminomethyl)-N-[3-[4-methyl-3-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 123986650) has the molecular formula C36H42N8O4 and a molecular weight of 650.78 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[4-methyl-3-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-[4-methyl-3-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123986650 |
| Molecular Formula | C36H42N8O4 |
| Molecular Weight | 650.78 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[4-methyl-3-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(CC(NC(=O)C2CCC(CN)CC2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)cc1-c1cccc(C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C36H42N8O4/c1-23-5-6-25(19-31(23)28-3-2-4-29(21-28)36(47)44-15-17-48-18-16-44)20-32(39-34(45)27-9-7-24(22-37)8-10-27)35(46)38-30-13-11-26(12-14-30)33-40-42-43-41-33/h2-6,11-14,19,21,24,27,32H,7-10,15-18,20,22,37H2,1H3,(H,38,46)(H,39,45)(H,40,41,42,43) |
| InChIKey | VLILSRQXTJYPJY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |