C36H42N8O3 — CID 123354430
4-(aminomethyl)-N-[1-oxo-3-[4-[2-(piperidine-1-carbonyl)phenyl]phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 123354430) has the molecular formula C36H42N8O3 and a molecular weight of 634.79 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[1-oxo-3-[4-[2-(piperidine-1-carbonyl)phenyl]phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[1-oxo-3-[4-[2-(piperidine-1-carbonyl)phenyl]phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123354430 |
| Molecular Formula | C36H42N8O3 |
| Molecular Weight | 634.79 g/mol |
| Exact Mass | 634.34 |
| IUPAC Name | 4-(aminomethyl)-N-[1-oxo-3-[4-[2-(piperidine-1-carbonyl)phenyl]phenyl]-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccc(-c3ccccc3C(=O)N3CCCCC3)cc2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C36H42N8O3/c37-23-25-10-14-28(15-11-25)34(45)39-32(35(46)38-29-18-16-27(17-19-29)33-40-42-43-41-33)22-24-8-12-26(13-9-24)30-6-2-3-7-31(30)36(47)44-20-4-1-5-21-44/h2-3,6-9,12-13,16-19,25,28,32H,1,4-5,10-11,14-15,20-23,37H2,(H,38,46)(H,39,45)(H,40,41,42,43) |
| InChIKey | DOXBVFHJFGOVAQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |