C35H40N8O4 — CID 123780777
4-(aminomethyl)-N-[3-[4-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 123780777) has the molecular formula C35H40N8O4 and a molecular weight of 636.76 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-[4-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[3-[4-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 123780777 |
| Molecular Formula | C35H40N8O4 |
| Molecular Weight | 636.76 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 4-(aminomethyl)-N-[3-[4-[3-(morpholine-4-carbonyl)phenyl]phenyl]-1-oxo-1-[4-(2H-tetrazol-5-yl)anilino]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)NC(Cc2ccc(-c3cccc(C(=O)N4CCOCC4)c3)cc2)C(=O)Nc2ccc(-c3nn[nH]n3)cc2)CC1 |
| InChI | InChI=1S/C35H40N8O4/c36-22-24-6-10-27(11-7-24)33(44)38-31(34(45)37-30-14-12-26(13-15-30)32-39-41-42-40-32)20-23-4-8-25(9-5-23)28-2-1-3-29(21-28)35(46)43-16-18-47-19-17-43/h1-5,8-9,12-15,21,24,27,31H,6-7,10-11,16-20,22,36H2,(H,37,45)(H,38,44)(H,39,40,41,42) |
| InChIKey | KZEHCELFUFZCST-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 168.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |