C37H45N9O3 — CID 123937500
3-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-5-methyl-N-piperidin-4-ylbenzamide (PubChem CID 123937500) has the molecular formula C37H45N9O3 and a molecular weight of 663.83 g/mol. Its IUPAC name is 3-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-5-methyl-N-piperidin-4-ylbenzamide.
| Compound Name | 3-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-5-methyl-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 123937500 |
| Molecular Formula | C37H45N9O3 |
| Molecular Weight | 663.83 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | 3-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-5-methyl-N-piperidin-4-ylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CCNCC2)cc(-c2ccc(CC(NC(=O)C3CCC(CN)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)cc2)c1 |
| InChI | InChI=1S/C37H45N9O3/c1-23-18-29(21-30(19-23)36(48)40-32-14-16-39-17-15-32)26-6-2-24(3-7-26)20-33(42-35(47)28-8-4-25(22-38)5-9-28)37(49)41-31-12-10-27(11-13-31)34-43-45-46-44-34/h2-3,6-7,10-13,18-19,21,25,28,32-33,39H,4-5,8-9,14-17,20,22,38H2,1H3,(H,40,48)(H,41,49)(H,42,47)(H,43,44,45,46) |
| InChIKey | PZHLRYIKOWCWQX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 179.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |