C39H49N9O3 — CID 123934459
4-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-3-methyl-N-[4-(methylamino)cyclohexyl]benzamide (PubChem CID 123934459) has the molecular formula C39H49N9O3 and a molecular weight of 691.88 g/mol. Its IUPAC name is 4-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-3-methyl-N-[4-(methylamino)cyclohexyl]benzamide.
| Compound Name | 4-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-3-methyl-N-[4-(methylamino)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 123934459 |
| Molecular Formula | C39H49N9O3 |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.40 |
| IUPAC Name | 4-[4-[2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-3-methyl-N-[4-(methylamino)cyclohexyl]benzamide |
| SMILES | CNC1CCC(NC(=O)c2ccc(-c3ccc(CC(NC(=O)C4CCC(CN)CC4)C(=O)Nc4ccc(-c5nn[nH]n5)cc4)cc3)c(C)c2)CC1 |
| InChI | InChI=1S/C39H49N9O3/c1-24-21-30(38(50)42-33-18-16-31(41-2)17-19-33)13-20-34(24)27-7-3-25(4-8-27)22-35(44-37(49)29-9-5-26(23-40)6-10-29)39(51)43-32-14-11-28(12-15-32)36-45-47-48-46-36/h3-4,7-8,11-15,20-21,26,29,31,33,35,41H,5-6,9-10,16-19,22-23,40H2,1-2H3,(H,42,50)(H,43,51)(H,44,49)(H,45,46,47,48) |
| InChIKey | YXTZLXMFKRQEFL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 179.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |