C38H49N9O3 — CID 122528217
4-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-N-[2-(diethylamino)ethyl]-3-methylbenzamide (PubChem CID 122528217) has the molecular formula C38H49N9O3 and a molecular weight of 679.87 g/mol. Its IUPAC name is 4-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-N-[2-(diethylamino)ethyl]-3-methylbenzamide.
| Compound Name | 4-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-N-[2-(diethylamino)ethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 122528217 |
| Molecular Formula | C38H49N9O3 |
| Molecular Weight | 679.87 g/mol |
| Exact Mass | 679.40 |
| IUPAC Name | 4-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-oxo-3-[4-(2H-tetrazol-5-yl)anilino]propyl]phenyl]-N-[2-(diethylamino)ethyl]-3-methylbenzamide |
| SMILES | CCN(CC)CCNC(=O)c1ccc(-c2ccc(C[C@H](NC(=O)C3CCC(CN)CC3)C(=O)Nc3ccc(-c4nn[nH]n4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C38H49N9O3/c1-4-47(5-2)21-20-40-36(48)31-16-19-33(25(3)22-31)28-10-6-26(7-11-28)23-34(42-37(49)30-12-8-27(24-39)9-13-30)38(50)41-32-17-14-29(15-18-32)35-43-45-46-44-35/h6-7,10-11,14-19,22,27,30,34H,4-5,8-9,12-13,20-21,23-24,39H2,1-3H3,(H,40,48)(H,41,50)(H,42,49)(H,43,44,45,46)/t27?,30?,34-/m0/s1 |
| InChIKey | STXVETOYFJSXER-MKGHJDHPSA-N |
| XLogP | 4.34 |
| TPSA | 171.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |