C42H54BrN3O7 — CID 10605311
(2-bromophenyl)methyl [4-[(2S)-3-(4-hexylanilino)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxopropyl]phenyl] carbonate (PubChem CID 10605311) has the molecular formula C42H54BrN3O7 and a molecular weight of 792.81 g/mol. Its IUPAC name is (2-bromophenyl)methyl [4-[(2S)-3-(4-hexylanilino)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxopropyl]phenyl] carbonate.
| Compound Name | (2-bromophenyl)methyl [4-[(2S)-3-(4-hexylanilino)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxopropyl]phenyl] carbonate |
|---|---|
| PubChem CID | 10605311 |
| Molecular Formula | C42H54BrN3O7 |
| Molecular Weight | 792.81 g/mol |
| Exact Mass | 791.31 |
| IUPAC Name | (2-bromophenyl)methyl [4-[(2S)-3-(4-hexylanilino)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]-3-oxopropyl]phenyl] carbonate |
| SMILES | CCCCCCc1ccc(NC(=O)[C@H](Cc2ccc(OC(=O)OCc3ccccc3Br)cc2)NC(=O)C2CCC(CNC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C42H54BrN3O7/c1-5-6-7-8-11-29-16-22-34(23-17-29)45-39(48)37(46-38(47)32-20-14-31(15-21-32)27-44-40(49)53-42(2,3)4)26-30-18-24-35(25-19-30)52-41(50)51-28-33-12-9-10-13-36(33)43/h9-10,12-13,16-19,22-25,31-32,37H,5-8,11,14-15,20-21,26-28H2,1-4H3,(H,44,49)(H,45,48)(H,46,47)/t31?,32?,37-/m0/s1 |
| InChIKey | SQPYCUUTAWFDCL-BPKZKJAXSA-N |
| XLogP | 9.28 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.81 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|