C31H35BrF5N5O4 — CID 122579620
tert-butyl N-[[4-[[(2S)-3-(4-bromophenyl)-1-oxo-1-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]amino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate (PubChem CID 122579620) has the molecular formula C31H35BrF5N5O4 and a molecular weight of 716.55 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(2S)-3-(4-bromophenyl)-1-oxo-1-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]amino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[[(2S)-3-(4-bromophenyl)-1-oxo-1-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]amino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 122579620 |
| Molecular Formula | C31H35BrF5N5O4 |
| Molecular Weight | 716.55 g/mol |
| Exact Mass | 715.18 |
| IUPAC Name | tert-butyl N-[[4-[[(2S)-3-(4-bromophenyl)-1-oxo-1-[[2-(1,1,2,2,2-pentafluoroethyl)-3H-benzimidazol-5-yl]amino]propan-2-yl]carbamoyl]cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)N[C@@H](Cc2ccc(Br)cc2)C(=O)Nc2ccc3nc(C(F)(F)C(F)(F)F)[nH]c3c2)CC1 |
| InChI | InChI=1S/C31H35BrF5N5O4/c1-29(2,3)46-28(45)38-16-18-4-8-19(9-5-18)25(43)40-24(14-17-6-10-20(32)11-7-17)26(44)39-21-12-13-22-23(15-21)42-27(41-22)30(33,34)31(35,36)37/h6-7,10-13,15,18-19,24H,4-5,8-9,14,16H2,1-3H3,(H,38,45)(H,39,44)(H,40,43)(H,41,42)/t18?,19?,24-/m0/s1 |
| InChIKey | VUEASMWUWMAHCY-MORLXBONSA-N |
| XLogP | 6.98 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.55 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|