C36H46BrN5O7 — CID 122552217
tert-butyl 3-[4-[[3-(4-bromophenyl)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]phenyl]-5-oxo-1H-pyrazole-2-carboxylate (PubChem CID 122552217) has the molecular formula C36H46BrN5O7 and a molecular weight of 740.70 g/mol. Its IUPAC name is tert-butyl 3-[4-[[3-(4-bromophenyl)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]phenyl]-5-oxo-1H-pyrazole-2-carboxylate.
| Compound Name | tert-butyl 3-[4-[[3-(4-bromophenyl)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]phenyl]-5-oxo-1H-pyrazole-2-carboxylate |
|---|---|
| PubChem CID | 122552217 |
| Molecular Formula | C36H46BrN5O7 |
| Molecular Weight | 740.70 g/mol |
| Exact Mass | 739.26 |
| IUPAC Name | tert-butyl 3-[4-[[3-(4-bromophenyl)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]phenyl]-5-oxo-1H-pyrazole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(C(=O)NC(Cc2ccc(Br)cc2)C(=O)Nc2ccc(-c3cc(=O)[nH]n3C(=O)OC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C36H46BrN5O7/c1-35(2,3)48-33(46)38-21-23-7-11-25(12-8-23)31(44)40-28(19-22-9-15-26(37)16-10-22)32(45)39-27-17-13-24(14-18-27)29-20-30(43)41-42(29)34(47)49-36(4,5)6/h9-10,13-18,20,23,25,28H,7-8,11-12,19,21H2,1-6H3,(H,38,46)(H,39,45)(H,40,44)(H,41,43) |
| InChIKey | KJCQGQWVJIQLFK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |