C41H44BrN3O8 — CID 11147124
(4-bromophenyl)methyl [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-3-oxopropyl]phenyl] carbonate (PubChem CID 11147124) has the molecular formula C41H44BrN3O8 and a molecular weight of 786.72 g/mol. Its IUPAC name is (4-bromophenyl)methyl [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-3-oxopropyl]phenyl] carbonate.
| Compound Name | (4-bromophenyl)methyl [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-3-oxopropyl]phenyl] carbonate |
|---|---|
| PubChem CID | 11147124 |
| Molecular Formula | C41H44BrN3O8 |
| Molecular Weight | 786.72 g/mol |
| Exact Mass | 785.23 |
| IUPAC Name | (4-bromophenyl)methyl [4-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butylamino]-3-oxopropyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)[C@H](Cc1ccc(OC(=O)OCc2ccc(Br)cc2)cc1)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C41H44BrN3O8/c1-41(2,3)53-38(47)44-23-9-8-22-43-37(46)36(24-27-16-20-30(21-17-27)52-40(49)51-25-28-14-18-29(42)19-15-28)45-39(48)50-26-35-33-12-6-4-10-31(33)32-11-5-7-13-34(32)35/h4-7,10-21,35-36H,8-9,22-26H2,1-3H3,(H,43,46)(H,44,47)(H,45,48)/t36-/m0/s1 |
| InChIKey | OXOCKRLXPLSKGK-BHVANESWSA-N |
| XLogP | 8.04 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|