C41H59BrClN3O7 — CID 10724140
[4-[[(2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-1-[(4-octoxycarbonylcyclohexyl)methylamino]-1-oxopropan-2-yl]carbamoyl]cyclohexyl]methylazanium chloride (PubChem CID 10724140) has the molecular formula C41H59BrClN3O7 and a molecular weight of 821.29 g/mol. Its IUPAC name is [4-[[(2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-1-[(4-octoxycarbonylcyclohexyl)methylamino]-1-oxopropan-2-yl]carbamoyl]cyclohexyl]methylazanium chloride.
| Compound Name | [4-[[(2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-1-[(4-octoxycarbonylcyclohexyl)methylamino]-1-oxopropan-2-yl]carbamoyl]cyclohexyl]methylazanium chloride |
|---|---|
| PubChem CID | 10724140 |
| Molecular Formula | C41H59BrClN3O7 |
| Molecular Weight | 821.29 g/mol |
| Exact Mass | 819.32 |
| IUPAC Name | [4-[[(2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-1-[(4-octoxycarbonylcyclohexyl)methylamino]-1-oxopropan-2-yl]carbamoyl]cyclohexyl]methylazanium chloride |
| SMILES | CCCCCCCCOC(=O)C1CCC(CNC(=O)[C@H](Cc2ccc(OC(=O)OCc3ccccc3Br)cc2)NC(=O)C2CCC(C[NH3+])CC2)CC1.[Cl-] |
| InChI | InChI=1S/C41H58BrN3O7.ClH/c1-2-3-4-5-6-9-24-50-40(48)33-20-14-31(15-21-33)27-44-39(47)37(45-38(46)32-18-12-30(26-43)13-19-32)25-29-16-22-35(23-17-29)52-41(49)51-28-34-10-7-8-11-36(34)42;/h7-8,10-11,16-17,22-23,30-33,37H,2-6,9,12-15,18-21,24-28,43H2,1H3,(H,44,47)(H,45,46);1H/t30?,31?,32?,33?,37-;/m0./s1 |
| InChIKey | DETJOCLFBFKCNK-NHFHUOJHSA-N |
| XLogP | 4.07 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.29 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|