C17H25N3O4 — CID 75467196
tert-butyl (2S)-2-[(4-methoxy-3-pyridinyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 75467196) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-methoxy-3-pyridinyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(4-methoxy-3-pyridinyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75467196 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl (2S)-2-[(4-methoxy-3-pyridinyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | COc1ccncc1NC(=O)[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N3O4/c1-17(2,3)24-16(22)20-10-6-5-7-13(20)15(21)19-12-11-18-9-8-14(12)23-4/h8-9,11,13H,5-7,10H2,1-4H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | JFJOABSGCVNKBV-ZDUSSCGKSA-N |
| XLogP | 2.82 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |