C18H26N2O4 — CID 41373974
tert-butyl (2R)-2-[(2-methoxy-5-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 41373974) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-methoxy-5-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(2-methoxy-5-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 41373974 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | tert-butyl (2R)-2-[(2-methoxy-5-methylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26N2O4/c1-12-8-9-15(23-5)13(11-12)19-16(21)14-7-6-10-20(14)17(22)24-18(2,3)4/h8-9,11,14H,6-7,10H2,1-5H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | DWAQWDGXOBLLQZ-CQSZACIVSA-N |
| XLogP | 3.34 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |