C17H23ClN2O4 — CID 11934895
tert-butyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 11934895) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11934895 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | tert-butyl (2S)-2-[(3-chloro-4-methoxyphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@@H]2CCCN2C(=O)OC(C)(C)C)cc1Cl |
| InChI | InChI=1S/C17H23ClN2O4/c1-17(2,3)24-16(22)20-9-5-6-13(20)15(21)19-11-7-8-14(23-4)12(18)10-11/h7-8,10,13H,5-6,9H2,1-4H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | AUSRUBDOFNQZDP-ZDUSSCGKSA-N |
| XLogP | 3.69 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |