C19H21F3N6 — CID 163344774
9-ethyl-6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]purine (PubChem CID 163344774) has the molecular formula C19H21F3N6 and a molecular weight of 390.41 g/mol. Its IUPAC name is 9-ethyl-6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]purine.
| Compound Name | 9-ethyl-6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]purine |
|---|---|
| PubChem CID | 163344774 |
| Molecular Formula | C19H21F3N6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 9-ethyl-6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]purine |
| SMILES | CCn1cnc2c(N3CCN(Cc4ccccc4C(F)(F)F)CC3)ncnc21 |
| InChI | InChI=1S/C19H21F3N6/c1-2-27-13-25-16-17(27)23-12-24-18(16)28-9-7-26(8-10-28)11-14-5-3-4-6-15(14)19(20,21)22/h3-6,12-13H,2,7-11H2,1H3 |
| InChIKey | ADQVXFDEXRMMTJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |