C20H24F3N5O — CID 154580986
4-[6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine (PubChem CID 154580986) has the molecular formula C20H24F3N5O and a molecular weight of 407.44 g/mol. Its IUPAC name is 4-[6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 154580986 |
| Molecular Formula | C20H24F3N5O |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 4-[6-[4-[[2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]pyrimidin-4-yl]morpholine |
| SMILES | FC(F)(F)c1ccccc1CN1CCN(c2cc(N3CCOCC3)ncn2)CC1 |
| InChI | InChI=1S/C20H24F3N5O/c21-20(22,23)17-4-2-1-3-16(17)14-26-5-7-27(8-6-26)18-13-19(25-15-24-18)28-9-11-29-12-10-28/h1-4,13,15H,5-12,14H2 |
| InChIKey | PCLQZNAQNQLGSW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 44.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |