C18H23FN4O — CID 136571637
4-benzyl-8-(6-fluoropyrimidin-4-yl)-1,4,8-oxadiazecane (PubChem CID 136571637) has the molecular formula C18H23FN4O and a molecular weight of 330.41 g/mol. Its IUPAC name is 4-benzyl-8-(6-fluoropyrimidin-4-yl)-1,4,8-oxadiazecane.
| Compound Name | 4-benzyl-8-(6-fluoropyrimidin-4-yl)-1,4,8-oxadiazecane |
|---|---|
| PubChem CID | 136571637 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 4-benzyl-8-(6-fluoropyrimidin-4-yl)-1,4,8-oxadiazecane |
| SMILES | Fc1cc(N2CCCN(Cc3ccccc3)CCOCC2)ncn1 |
| InChI | InChI=1S/C18H23FN4O/c19-17-13-18(21-15-20-17)23-8-4-7-22(9-11-24-12-10-23)14-16-5-2-1-3-6-16/h1-3,5-6,13,15H,4,7-12,14H2 |
| InChIKey | RJEOIJZKNCYWQA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |