C16H18F2N4 — CID 126850021
4-(4-benzylpiperazin-1-yl)-6-(difluoromethyl)pyrimidine (PubChem CID 126850021) has the molecular formula C16H18F2N4 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-6-(difluoromethyl)pyrimidine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-6-(difluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 126850021 |
| Molecular Formula | C16H18F2N4 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-6-(difluoromethyl)pyrimidine |
| SMILES | FC(F)c1cc(N2CCN(Cc3ccccc3)CC2)ncn1 |
| InChI | InChI=1S/C16H18F2N4/c17-16(18)14-10-15(20-12-19-14)22-8-6-21(7-9-22)11-13-4-2-1-3-5-13/h1-5,10,12,16H,6-9,11H2 |
| InChIKey | BTCOPCGFZYMSIX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |