C15H16F3N5 — CID 171995248
4-(difluoromethyl)-6-[4-[(3-fluoro-2-pyridinyl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 171995248) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-[4-[(3-fluoro-2-pyridinyl)methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-(difluoromethyl)-6-[4-[(3-fluoro-2-pyridinyl)methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 171995248 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 4-(difluoromethyl)-6-[4-[(3-fluoro-2-pyridinyl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | Fc1cccnc1CN1CCN(c2cc(C(F)F)ncn2)CC1 |
| InChI | InChI=1S/C15H16F3N5/c16-11-2-1-3-19-13(11)9-22-4-6-23(7-5-22)14-8-12(15(17)18)20-10-21-14/h1-3,8,10,15H,4-7,9H2 |
| InChIKey | GRVOUHDCTQYKGO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |